CAS 79996-93-3

4-(Hydroxymethyl)-2-naphthalenecarbonitrile

Description:

4-(Hydroxymethyl)-2-naphthalenecarbonitrile, with the CAS number 79996-93-3, is an organic compound characterized by its naphthalene structure, which features a hydroxymethyl group and a nitrile functional group. This compound typically appears as a solid and is known for its aromatic properties due to the naphthalene ring system. The presence of the hydroxymethyl group (-CH2OH) contributes to its reactivity, allowing for potential interactions in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The nitrile group (-C≡N) is known for its ability to participate in further chemical transformations, including hydrolysis and reduction. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its functional groups that can serve as intermediates in more complex chemical structures. Additionally, its solubility and stability in various solvents can influence its applications in research and industry. Overall, 4-(Hydroxymethyl)-2-naphthalenecarbonitrile is a versatile compound with significant potential in synthetic chemistry.

Formula: C₁₂H₉NO

InChI: InChI=1S/C12H9NO/c13-7-9-5-10-3-1-2-4-12(10)11(6-9)8-14/h1-6,14H,8H2

InChI key: InChIKey=QYYNJONAFQOCJS-UHFFFAOYSA-N

SMILES: C(O)C=1C2=C(C=C(C#N)C1)C=CC=C2

Synonyms:

• 2-Naphthalenecarbonitrile, 4-(hydroxymethyl)-
• 4-(Hydroxymethyl)-2-naphthalenecarbonitrile
• 3-Cyano-1-hydroxymethylnaphthalene