CAS 79996-98-8

1-(bromomethyl)-4-chloronaphthalene

Description:

1-(Bromomethyl)-4-chloronaphthalene is an organic compound characterized by its naphthalene backbone, which is a polycyclic aromatic hydrocarbon. This compound features a bromomethyl group (-CH2Br) and a chloromethyl group (-Cl) attached to the naphthalene ring, specifically at the 1 and 4 positions, respectively. It is typically a colorless to pale yellow solid with a distinct aromatic odor. The presence of halogen substituents contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the production of pharmaceuticals and agrochemicals. The compound is moderately soluble in organic solvents but has limited solubility in water due to its hydrophobic naphthalene structure. Safety precautions should be taken when handling this substance, as it may pose health risks, including potential carcinogenicity associated with halogenated aromatic compounds. Proper storage in a cool, dry place away from light is recommended to maintain its stability.

Formula: C₁₁H₈BrCl

InChI: InChI=1/C11H8BrCl/c12-7-8-5-6-11(13)10-4-2-1-3-9(8)10/h1-6H,7H2

1-(Bromomethyl)-4-chloronaphthalene

CAS: 79996-98-8

Versatile small molecule scaffold

Formula: C₁₁H₈BrCl

Purity: Min. 95%

Molecular weight: 255.54 g/mol

Ref: 3D-EDA99698