CAS 79999-39-6
:2',3',5'-Tri-O-Acetyl-2-chloroadenosine
Description:
2',3',5'-Tri-O-Acetyl-2-chloroadenosine is a modified nucleoside derivative of adenosine, characterized by the presence of three acetyl groups attached to the hydroxyl groups at the 2', 3', and 5' positions of the ribose sugar, along with a chlorine atom at the 2-position of the adenine base. This compound is typically used in biochemical research and synthetic chemistry due to its ability to mimic natural nucleosides while providing unique reactivity and stability properties. The acetyl groups enhance lipophilicity, facilitating cellular uptake, while the chlorination can influence biological activity and interaction with nucleic acid targets. As a result, 2',3',5'-Tri-O-Acetyl-2-chloroadenosine is often employed in studies related to nucleoside analogs, antiviral drug development, and the exploration of nucleic acid functions. Its CAS number, 79999-39-6, allows for precise identification in chemical databases and literature. Overall, this compound serves as a valuable tool in the fields of medicinal chemistry and molecular biology.
Formula:C16H18ClN5O7
InChI:InChI=1/C16H18ClN5O7/c1-6(23)26-4-9-11(27-7(2)24)12(28-8(3)25)15(29-9)22-5-19-10-13(18)20-16(17)21-14(10)22/h5,9,11-12,15H,4H2,1-3H3,(H2,18,20,21)/t9-,11+,12+,15-/m1/s1
Synonyms:- 2-Chloroadenosine 2',3',5'-triacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2'',3'',5-Tri-O-acetyl-2-chloroadenosine
CAS:Formula:C16H18ClN5O7Purity:(HPLC) ≥ 95.0%Color and Shape:Conflicting attributes definedMolecular weight:427.802-Chloro-6-amino-9-(2’,3’,5’-tri-O-acetyl-β-D-ribofuranosyl)purine
CAS:Controlled ProductApplications 2-Chloro-6-amino-9-(2’,3’,5’-tri-O-acetyl-β-D-ribofuranosyl)purine (cas# 79999-39-6) is a compound useful in organic synthesis.
Formula:C16H18ClN5O7Color and Shape:NeatMolecular weight:427.82',3',5-Tri-O-acetyl-2-chloroadenosine
CAS:2',3',5-Tri-O-acetyl-2-chloroadenosine is a modified nucleoside that has been shown to be a potent activator of the transcriptional activator protein 2 (AP2) and AP1. The ribonucleosides are synthesized by phosphoramidite chemistry and are prepared as monophosphate or diphosphate derivatives. 2',3',5-Tri-O-acetyl-2-chloroadenosine also has antiviral activity against herpes simplex virus type 1 (HSV1). This drug is highly purified and can be used in high quality applications, such as anticancer and antiviral treatments.
Formula:C16H18ClN5O7Purity:Min. 95%Molecular weight:427.8 g/mol




