
CAS 80-16-0
:N-Chlorobenzenesulfonamide
Description:
N-Chlorobenzenesulfonamide, with the CAS number 80-16-0, is an organic compound characterized by the presence of a chlorinated benzene ring attached to a sulfonamide group. This compound typically appears as a white to off-white crystalline solid and is known for its stability under standard conditions. It is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. N-Chlorobenzenesulfonamide exhibits antimicrobial properties, making it valuable in pharmaceutical formulations and as a reagent in organic synthesis. The presence of the chlorine atom contributes to its reactivity, allowing it to participate in electrophilic substitution reactions. Additionally, the sulfonamide functional group imparts unique chemical properties, including the ability to form hydrogen bonds, which can influence its biological activity. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken. Overall, N-Chlorobenzenesulfonamide is a versatile compound with significant applications in both research and industry.
Formula:C6H6ClNO2S
InChI:InChI=1S/C6H6ClNO2S/c7-8-11(9,10)6-4-2-1-3-5-6/h1-5,8H
InChI key:InChIKey=CHVZPRDGLWBEMJ-UHFFFAOYSA-N
SMILES:S(NCl)(=O)(=O)C1=CC=CC=C1
Synonyms:- Benzenesulfonamide, N-chloro-
- N-Chlorobenzenesulfonamide
- Phenylsulfamyl chloride
- Benzenesulfochloramide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chloramine-B
CAS:Chloramine-B can be used in dichloroimination of indoles.Formula:C6H6ClNO2SColor and Shape:SolidMolecular weight:191.63
