
CAS 80-22-8
:3-Amino-N-butyl-4-methoxybenzenesulfonamide
Description:
3-Amino-N-butyl-4-methoxybenzenesulfonamide, with the CAS number 80-22-8, is a chemical compound that belongs to the class of sulfonamides. It features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2) attached to an amine. This compound has a butyl group and a methoxy group, contributing to its hydrophobic and hydrophilic properties, respectively. The amino group provides basic characteristics, allowing it to participate in various chemical reactions, including nucleophilic substitutions. It is often used in pharmaceutical applications due to its potential biological activity, particularly as an antibacterial agent. The presence of the methoxy group can influence the compound's solubility and reactivity, making it suitable for various synthetic pathways. Additionally, the sulfonamide moiety is known for its ability to form hydrogen bonds, which can enhance its interactions with biological targets. Overall, 3-Amino-N-butyl-4-methoxybenzenesulfonamide is a versatile compound with significant implications in medicinal chemistry.
Formula:C11H18N2O3S
InChI:InChI=1S/C11H18N2O3S/c1-3-4-7-13-17(14,15)9-5-6-11(16-2)10(12)8-9/h5-6,8,13H,3-4,7,12H2,1-2H3
InChI key:InChIKey=XOIMPHNXVTYJAB-UHFFFAOYSA-N
SMILES:S(NCCCC)(=O)(=O)C1=CC(N)=C(OC)C=C1
Synonyms:- Fast Ponceau L Base
- Benzenesulfonamide, 3-amino-N-butyl-4-methoxy-
- Azoene Fast Red PDC Base
- Metanilamide, N1-butyl-4-methoxy-
- 3-Amino-N-butyl-4-methoxybenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.