
CAS 80-28-4
:4-Methyl-N-(2-methylphenyl)benzenesulfonamide
Description:
4-Methyl-N-(2-methylphenyl)benzenesulfonamide, also known by its CAS number 80-28-4, is an organic compound that belongs to the class of sulfonamides. This substance features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2) attached to an amine. The compound has a complex structure that includes a benzene ring substituted with a methyl group and an aniline derivative, contributing to its unique chemical properties. It is typically a solid at room temperature and is known for its potential applications in pharmaceuticals, particularly as an antibacterial agent. The presence of the sulfonamide group imparts certain biological activities, making it relevant in medicinal chemistry. Additionally, this compound may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many sulfonamides. Safety data should be consulted for handling and exposure, as with all chemical substances, to ensure proper laboratory practices.
Formula:C14H15NO2S
InChI:InChI=1S/C14H15NO2S/c1-11-7-9-13(10-8-11)18(16,17)15-14-6-4-3-5-12(14)2/h3-10,15H,1-2H3
InChI key:InChIKey=SIPGNSRRMHEOSA-UHFFFAOYSA-N
SMILES:S(NC1=C(C)C=CC=C1)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:- p-Toluenesulfono-o-toluidide
- N-(2-Methylphenyl)-p-toluenesulfonamide
- Benzenesulfonamide, 4-methyl-N-(2-methylphenyl)-
- 4-Methyl-N-(2-methylphenyl)benzenesulfonamide
- NSC 48377
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.