CAS 80-69-3
:Tartronic acid
Description:
Tartronic acid, with the CAS number 80-69-3, is a dicarboxylic acid that is structurally related to tartaric acid. It is characterized by the presence of two carboxyl (-COOH) groups attached to a three-carbon chain. This compound is typically found in a white crystalline form and is soluble in water, which makes it useful in various chemical applications. Tartronic acid exhibits properties such as being a chiral molecule, meaning it has non-superimposable mirror images, which can influence its reactivity and interactions in biological systems. It can act as a reducing agent and is involved in various organic synthesis processes. Additionally, tartronic acid can be used in the production of certain pharmaceuticals and as a precursor in the synthesis of other chemical compounds. Its ability to form salts and esters further expands its utility in chemical reactions and applications. Overall, tartronic acid is a versatile compound with significant relevance in both industrial and research settings.
Formula:C3H4O5
InChI:InChI=1S/C3H4O5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6)(H,7,8)
InChI key:InChIKey=ROBFUDYVXSDBQM-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C(O)=O)O
Synonyms:- 2-Hydroxymalonic acid
- 2-Hydroxypropanedioic acid
- Hydroxymalonic acid
- Hydroxypropanedioate
- Hydroxypropanedioic Acid
- Malonic Acid, Hydroxy-
- Nsc 36171
- Propanedioic acid, 2-hydroxy-
- Propanedioic acid, hydroxy-
- α-Hydroxymalonic acid
- Tartronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Tartronic acid, 97%
CAS:Tartronic acid is used as a reactant in the catalytic oxidation with air to form mesoxalic acid. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar proFormula:C3H4O5Purity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:120.062-Hydroxymalonic acid
CAS:2-Hydroxymalonic acid inhibits serine racemase (IC₅₀ = 94 µM) and can be used in related research in the field of life sciences.Formula:C3H4O5Purity:99.77%Color and Shape:SolidMolecular weight:120.06Hydroxymalonic Acid
CAS:Controlled ProductApplications HYDROXYMALONIC ACID (cas# 80-69-3) is a useful research chemical.
Formula:C3H4O5Color and Shape:NeatMolecular weight:120.06






