CAS 80-72-8
:2,3-dihydroxycyclopent-2-enone
Description:
2,3-Dihydroxycyclopent-2-enone, with the CAS number 80-72-8, is an organic compound characterized by its unique bicyclic structure featuring a cyclopentene ring with two hydroxyl (-OH) groups at the 2 and 3 positions and a ketone functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits a range of chemical properties, including the ability to participate in hydrogen bonding due to the presence of hydroxyl groups, which can influence its solubility in polar solvents. The compound is known for its reactivity, particularly in nucleophilic addition reactions, owing to the electrophilic nature of the carbonyl group. Additionally, it can undergo tautomerization, leading to the formation of different isomeric forms. 2,3-Dihydroxycyclopent-2-enone is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in the development of pharmaceuticals and other chemical products.
Formula:C5H6O3
InChI:InChI=1/C5H6O3/c6-3-1-2-4(7)5(3)8/h6,8H,1-2H2
SMILES:C1CC(=O)C(=C1O)O
Synonyms:- Reductic Acid
- 2,3-Dihydroxycyclopent-2-En-1-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.