
CAS 80-79-5
:3-Amino-2-hydroxybenzenesulfonic acid
Description:
3-Amino-2-hydroxybenzenesulfonic acid, commonly known as "o-aminophenol sulfonic acid," is an organic compound characterized by its amino and hydroxyl functional groups attached to a benzene ring, along with a sulfonic acid group. This compound is typically a white to light yellow crystalline solid that is soluble in water, reflecting its polar nature due to the presence of the sulfonic acid group. It exhibits properties such as being a weak acid, with the ability to donate protons in solution. The amino group allows it to participate in various chemical reactions, including electrophilic substitution and coupling reactions, making it useful in dye synthesis and as a reagent in analytical chemistry. Additionally, its hydroxyl group contributes to its reactivity and potential applications in pharmaceuticals and as an intermediate in organic synthesis. Safety considerations include handling it with care, as it may cause irritation to the skin and eyes. Overall, 3-amino-2-hydroxybenzenesulfonic acid is a versatile compound with significant applications in both industrial and laboratory settings.
Formula:C6H7NO4S
InChI:InChI=1S/C6H7NO4S/c7-4-2-1-3-5(6(4)8)12(9,10)11/h1-3,8H,7H2,(H,9,10,11)
InChI key:InChIKey=UARPFAZLXITZKP-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(O)C(N)=CC=C1
Synonyms:- 2-Hydroxymetanilic acid
- Benzenesulfonic acid, 3-amino-2-hydroxy-
- 3-Amino-2-hydroxybenzene-1-sulfonic acid
- 3-Amino-2-hydroxybenzenesulfonic acid
- Metanilic acid, 2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
