
CAS 800-22-6
:Chloracizine
Description:
Chloracizine, identified by its CAS number 800-22-6, is a chemical compound that belongs to the class of antipsychotic medications. It is primarily characterized by its structure, which includes a chlorinated aromatic ring, contributing to its pharmacological properties. Chloracizine exhibits a range of biological activities, particularly in the central nervous system, where it acts as a dopamine antagonist. This mechanism is crucial for its therapeutic effects in treating various psychiatric disorders. The compound is typically administered in a controlled dosage to manage side effects and optimize efficacy. Additionally, Chloracizine's solubility, stability, and reactivity are influenced by its chemical structure, which can affect its formulation and delivery in pharmaceutical applications. Safety and toxicity profiles are essential considerations in its use, necessitating thorough evaluation in clinical settings. Overall, Chloracizine represents a significant compound in the field of medicinal chemistry, with ongoing research aimed at understanding its full potential and optimizing its therapeutic applications.
Formula:C19H21ClN2OS
InChI:InChI=1S/C19H21ClN2OS/c1-3-21(4-2)12-11-19(23)22-15-7-5-6-8-17(15)24-18-10-9-14(20)13-16(18)22/h5-10,13H,3-4,11-12H2,1-2H3
InChI key:InChIKey=ZZKWNLZUYAGVOT-UHFFFAOYSA-N
SMILES:C(CCN(CC)CC)(=O)N1C=2C(SC=3C1=CC=CC3)=CC=C(Cl)C2
Synonyms:- Phenothiazine, 2-chloro-10-(N,N-diethyl-β-alanyl)-
- 1-Propanone, 1-(2-chloro-10H-phenothiazin-10-yl)-3-(diethylamino)-
- 10H-Phenothiazine, 2-chloro-10-[3-(diethylamino)-1-oxopropyl]-
- Chloracizin
- 1-(2-Chloro-10H-phenothiazin-10-yl)-3-(diethylamino)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chloracyzine
CAS:<p>Chloracyzine lowers heart oxygen use, shrinks coronary flow after brief dilation, slightly ups heart rate and arterial pressure.</p>Formula:C19H21ClN2OSColor and Shape:SolidMolecular weight:360.9
