CAS 80003-58-3

2-Oxo-5-hexenoic acid

Description:

2-Oxo-5-hexenoic acid, with the CAS number 80003-58-3, is an organic compound characterized by its unique structure, which includes a ketone functional group and a carboxylic acid group. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive odor. It is classified as an unsaturated fatty acid due to the presence of a double bond in its carbon chain. The presence of both the ketone and carboxylic acid functionalities contributes to its reactivity, making it a potential intermediate in various organic synthesis processes. 2-Oxo-5-hexenoic acid can participate in reactions such as condensation, esterification, and addition reactions, which are valuable in the production of more complex molecules. Additionally, it may exhibit biological activity, although specific applications and effects can vary. As with many organic compounds, handling should be done with care, considering potential hazards associated with its chemical properties.

Formula: C₆H₈O₃

InChI: InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2H,1,3-4H2,(H,8,9)

InChI key: InChIKey=SRSUTBIWADPHRS-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CCC=C)=O

Synonyms:

• 5-Hexenoic acid, 2-oxo-
• 2-Oxo-5-hexenoic acid

2-Oxohex-5-enoic acid

CAS: 80003-58-3

2-Oxohex-5-enoic acid

Purity: 95% +(stabilized with TBC)

Molecular weight: 128.13g/mol

Ref: 54-OR1074999