CymitQuimica logo

CAS 80004-03-1

:

1,4,7,10,13-Pentaoxacyclopentadecane-2-methanol, (S)-

Description:
1,4,7,10,13-Pentaoxacyclopentadecane-2-methanol, (S)-, with CAS number 80004-03-1, is a cyclic polyether compound characterized by a five-membered ring structure containing multiple ether linkages. This compound features five oxygen atoms integrated into its cyclic framework, contributing to its unique chemical properties, such as increased solubility in polar solvents and potential applications in drug delivery systems or as a ligand in coordination chemistry. The presence of a hydroxymethyl group (-CH2OH) at the second carbon enhances its reactivity and solubility, making it suitable for various chemical reactions. The (S)- designation indicates that the compound has a specific stereochemistry, which can influence its biological activity and interactions with other molecules. Generally, compounds like this may exhibit low toxicity and biocompatibility, making them of interest in pharmaceutical and materials science research. Its structural characteristics and functional groups suggest potential applications in fields such as organic synthesis, materials science, and medicinal chemistry.
Formula:C11H22O6
InChI:InChI=1S/C11H22O6/c12-9-11-10-16-6-5-14-2-1-13-3-4-15-7-8-17-11/h11-12H,1-10H2/t11-/m0/s1
InChI key:InChIKey=YHIQMMGCRYKJLB-NSHDSACASA-N
SMILES:C(O)[C@H]1COCCOCCOCCOCCO1
Synonyms:
  • 1,4,7,10,13-Pentaoxacyclopentadecane-2-methanol, (S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.