
CAS 80004-04-2
:1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanol, (2S)-
Description:
1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanol, also known by its CAS number 80004-04-2, is a cyclic polyether compound characterized by a unique structure that includes multiple ether linkages. This compound features a cyclic arrangement of six ether groups, which contributes to its stability and solubility in various solvents. The presence of a methanol group at the 2-position introduces a hydroxyl functional group, enhancing its potential for hydrogen bonding and increasing its polarity. As a result, this compound may exhibit interesting properties such as low volatility and high thermal stability. It is often studied for its applications in materials science, particularly in the development of polymers and as a potential component in drug delivery systems due to its biocompatibility. Additionally, the cyclic nature of the molecule may impart unique conformational characteristics, influencing its interactions with other chemical species. Overall, 1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanol is a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C13H26O7
InChI:InChI=1S/C13H26O7/c14-11-13-12-19-8-7-17-4-3-15-1-2-16-5-6-18-9-10-20-13/h13-14H,1-12H2/t13-/m0/s1
InChI key:InChIKey=HFRGASADQCZXHH-ZDUSSCGKSA-N
SMILES:C(O)[C@H]1COCCOCCOCCOCCOCCO1
Synonyms:- 1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanol, (2S)-
- (S)-1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanol
- 1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanol, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
