CAS 80010-98-6

3,4-dihydrocyclopenta[cd]pyren-4-ol

Description:

3,4-Dihydrocyclopenta[cd]pyren-4-ol is an organic compound characterized by its polycyclic aromatic structure, which includes fused cyclopentane and pyrene rings. This compound features a hydroxyl (-OH) group, which contributes to its chemical reactivity and solubility properties. The presence of the hydroxyl group typically enhances its polarity compared to non-hydroxylated polycyclic aromatic hydrocarbons, potentially affecting its interactions in biological systems and environmental contexts. 3,4-Dihydrocyclopenta[cd]pyren-4-ol may exhibit interesting photophysical properties, making it of interest in fields such as materials science and organic electronics. Additionally, due to its structural characteristics, it may be studied for its potential biological activity, including any mutagenic or carcinogenic properties associated with polycyclic aromatic compounds. Its CAS number, 80010-98-6, allows for precise identification in chemical databases and literature. Overall, this compound represents a unique intersection of organic chemistry and potential applications in various scientific domains.

Formula: C₁₈H₁₂O

InChI: InChI=1/C18H12O/c19-15-9-13-7-6-11-5-4-10-2-1-3-12-8-14(15)17(13)18(11)16(10)12/h1-8,15,19H,9H2

SMILES: c1cc2ccc3ccc4CC(c5cc(c1)c2c3c45)O

Synonyms:

• Cyclopenta(cd)pyren-4-ol, 3,4-dihydro-

3,4-Dihydrocyclopenta[cd]pyren-4-ol

Controlled Product

CAS: 80010-98-6

Formula: C₁₈H₁₂O

Color and Shape: Neat

Molecular weight: 244.287

Ref: TR-D453710