
CAS 80012-14-2
:(3E)-4-Amino-3-penten-2-one
Description:
(3E)-4-Amino-3-penten-2-one, with the CAS number 80012-14-2, is an organic compound characterized by its unique structure, which includes an amino group and a conjugated double bond system. This compound features a five-carbon chain with a double bond between the second and third carbons, and an amino group attached to the fourth carbon. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the conjugated double bond system contributes to its reactivity and potential applications in organic synthesis. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in laboratory settings.
Formula:C5H9NO
InChI:InChI=1S/C5H9NO/c1-4(6)3-5(2)7/h3H,6H2,1-2H3/b4-3+
InChI key:InChIKey=OSLAYKKXCYSJSF-ONEGZZNKSA-N
SMILES:C(=C(\C)/N)\C(C)=O
Synonyms:- 3-Penten-2-one, 4-amino-, (3E)-
- 3-Penten-2-one, 4-amino-, (E)-
- (3E)-4-Amino-3-penten-2-one
- (E)-4-Amino-3-penten-2-one
- (E)-4-Aminopent-3-en-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.