CAS 80015-51-6

2'-deoxy-5-[(E)-2-fluoroethenyl]uridine

Description:

2'-Deoxy-5-[(E)-2-fluoroethenyl]uridine, with the CAS number 80015-51-6, is a nucleoside analog that features a modified uridine structure. This compound is characterized by the presence of a 2-fluoroethenyl group at the 5-position of the uridine base, which enhances its antiviral properties. The modification at the 2' position, where the hydroxyl group is replaced by a hydrogen atom, contributes to its stability and resistance to nucleases, making it a potential candidate for therapeutic applications, particularly in antiviral treatments. The compound exhibits a unique mechanism of action, often interfering with viral replication processes. Its structural modifications can influence its binding affinity to viral enzymes and its overall pharmacokinetic profile. As a nucleoside analog, it may also exhibit cytotoxic effects on rapidly dividing cells, which is a common characteristic of many antiviral agents. Overall, 2'-deoxy-5-[(E)-2-fluoroethenyl]uridine represents a significant area of research in medicinal chemistry and virology.

Formula: C₁₁H₁₃FN₂O₅

InChI: InChI=1/C11H13FN2O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h1-2,4,7-9,15-16H,3,5H2,(H,13,17,18)/b2-1+/t7-,8+,9+/m0/s1

5-(2-Fluorovinyl)-2'-Deoxyuridine

CAS: 80015-51-6

5-(2-Fluorovinyl)-2'-Deoxyuridine is a hydrophobic analogue of acyclovir that has potent activity against herpes simplex virus type 1. It inhibits the synthesis of viral DNA, and thus prevents the formation of plaques in tissue culture. This drug also inhibits cell proliferation and viral production by l1210 cells as well as lung fibroblasts. 5-(2-Fluorovinyl)-2'-Deoxyuridine has shown inhibitory effects against uninfected cells, but not against cells infected with herpes simplex virus type 2.

Formula: C₁₁H₁₃FN₂O₅

Purity: Min. 95%

Molecular weight: 272.23 g/mol

Ref: 3D-FF81058