CAS 80023-25-2

3-Chloro-2-cyanobenzenesulfonyl chloride

Description:

3-Chloro-2-cyanobenzenesulfonyl chloride, with the CAS number 80023-25-2, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that also features a chloro and a cyano substituent. This compound typically appears as a solid or crystalline substance and is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The presence of the cyano group contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the chlorine atom enhances its electrophilic character, making it useful in various chemical transformations. Safety precautions are essential when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Overall, 3-Chloro-2-cyanobenzenesulfonyl chloride is a versatile intermediate in synthetic organic chemistry.

Formula: C₇H₃Cl₂NO₂S

InChI: InChI=1S/C7H3Cl2NO2S/c8-6-2-1-3-7(5(6)4-10)13(9,11)12/h1-3H

InChI key: InChIKey=FJRVDPLJNHWGSE-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(C#N)C(Cl)=CC=C1

Synonyms:

• 3-Chloro-2-cyanobenzene-1-sulfonyl chloride
• 3-Chloro-2-cyanobenzenesulfonyl chloride
• 2-Cyano-3-chlorobenzenesulfonyl chloride
• Benzenesulfonyl chloride, 3-chloro-2-cyano-