CAS 80023-40-1

thiomorpholine-3,5-dione

Description:

Thiomorpholine-3,5-dione, identified by its CAS number 80023-40-1, is a heterocyclic organic compound characterized by a morpholine ring containing sulfur and two carbonyl groups at the 3 and 5 positions. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, which is indicative of its functional groups. The presence of the dione structure contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic additions and cyclization processes. Thiomorpholine-3,5-dione may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in synthesizing other complex molecules. As with many sulfur-containing compounds, it may possess distinct odor characteristics. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, thiomorpholine-3,5-dione is a versatile compound with potential utility in various chemical and pharmaceutical applications.

Formula: C₄H₅NO₂S

InChI: InChI=1/C4H5NO2S/c6-3-1-8-2-4(7)5-3/h1-2H2,(H,5,6,7)

SMILES: C1C(=NC(=O)CS1)O

Synonyms:

• 3,5-Thiomorpholinedione

3,5-Thiomorpholinedione

CAS: 80023-40-1

Purity: 95%

Molecular weight: 131.1499939

Ref: 10-F653325

Thiomorpholine-3,5-dione

CAS: 80023-40-1

Thiomorpholine-3,5-dione is a chemical compound that has an x-ray crystal structure. It was first synthesized in 1892 and was the first organic molecule with a herringbone molecular geometry to be discovered. Thiomorpholine-3,5-dione is used as a precursor for dyes, pharmaceuticals, and other organic compounds.

Formula: C₄H₅NO₂S

Purity: Min. 95%

Molecular weight: 131.16 g/mol

Ref: 3D-FDA02340