CAS 80035-32-1
:2-[(2R,4R,5S)-2-benzyloxy-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]isoindoline-1,3-dione
Description:
The chemical substance known as 2-[(2R,4R,5S)-2-benzyloxy-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]isoindoline-1,3-dione, with the CAS number 80035-32-1, is a complex organic compound characterized by its unique structural features. It contains a tetrahydropyran ring, which is a six-membered cyclic ether, and an isoindoline moiety, indicating a fused bicyclic structure. The presence of multiple hydroxyl groups suggests that the compound may exhibit significant polarity and potential for hydrogen bonding, which can influence its solubility and reactivity. The benzyloxy group enhances the compound's lipophilicity, potentially affecting its biological activity. This compound may be of interest in medicinal chemistry due to its structural complexity and the presence of functional groups that could interact with biological targets. Its stereochemistry, indicated by the specific R and S configurations, may also play a crucial role in its pharmacological properties. Overall, this substance represents a class of compounds that could have applications in drug development or as intermediates in organic synthesis.
Formula:C21H21NO7
InChI:InChI=1/C21H21NO7/c23-10-15-17(24)18(25)16(21(29-15)28-11-12-6-2-1-3-7-12)22-19(26)13-8-4-5-9-14(13)20(22)27/h1-9,15-18,21,23-25H,10-11H2/t15?,16?,17-,18-,21-/m1/s1
SMILES:c1ccc(cc1)CO[C@H]1C([C@H]([C@@H](C(CO)O1)O)O)N1C(=O)c2ccccc2C1=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzyl 2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:Benzyl 2-deoxy-2-phthalimido-β-D-glucopyranosideMolecular weight:399.39393g/molBenzyl 2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:Benzyl 2-deoxy-2-phthalimido-b-D-glucopyranoside is a custom synthesis that belongs to the group of complex carbohydrates. It is an oligosaccharide or polysaccharide that is modified with methylation, glycosylation, and carbamylation, and has a CAS number of 80035-32-1. This compound has been used in the synthesis of saccharides for the preparation of an antibody drug conjugate. Benzyl 2-deoxy-2-phthalimido-b-D-glucopyranoside is also known as 6Fluoro 3 indoxyl beta D galactopyranoside.Formula:C21H21NO7Purity:Min. 95%Molecular weight:399.39 g/molBenzyl 2-Deoxy-2-phthalimido-beta-D-glucopyranoside (~90%)
CAS:Controlled ProductApplications Benzyl 2-Deoxy-2-phthalimido-β-D-glucopyranoside (~90%) (cas# 80035-32-1) is a compound useful in organic synthesis.
Formula:C21H21NO7Purity:~90%Color and Shape:NeatMolecular weight:399.39



