CymitQuimica logo

CAS 800401-53-0

:

5-Cyano-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

Description:
5-Cyano-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine structures, which contribute to its unique chemical properties. This compound features a cyano group (-CN) and a carboxylic acid group (-COOH), making it a versatile building block in organic synthesis and medicinal chemistry. The presence of the cyano group enhances its reactivity, allowing for various chemical transformations, while the carboxylic acid group can participate in hydrogen bonding and serve as a site for further functionalization. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of biologically active molecules. Its solubility and stability in various solvents can vary, depending on the specific conditions and the presence of other functional groups. Overall, 5-Cyano-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid is notable for its structural complexity and potential utility in synthetic organic chemistry.
Formula:C9H5N3O2
InChI:InChI=1S/C9H5N3O2/c10-4-5-1-2-6-7(11-5)3-8(12-6)9(13)14/h1-3,12H,(H,13,14)
InChI key:InChIKey=FYMNETUBQDEDKO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(N1)=CC=C(C#N)N2
Synonyms:
  • 5-Cyano-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid
  • 1H-Pyrrolo[3,2-b]pyridine-2-carboxylic acid, 5-cyano-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.