CAS 800401-54-1

5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

Description:

5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position and a carboxylic acid functional group at the 2-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits moderate stability under standard conditions but may undergo reactions typical of carboxylic acids, such as esterification or amidation. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrole and pyridine derivatives. Additionally, the compound's ability to form hydrogen bonds and participate in π-π stacking interactions may influence its behavior in biological systems and materials science. Overall, 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid is a versatile compound with significant implications in various chemical and pharmaceutical contexts.

Formula: C₈H₅ClN₂O₂

InChI: InChI=1/C8H5ClN2O2/c9-7-2-1-4-5(11-7)3-6(10-4)8(12)13/h1-3,10H,(H,12,13)

SMILES: c1cc(Cl)nc2cc(C(=O)O)[nH]c12

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-2-carboxylic acid, 5-chloro-
• 5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

6-CHLORO-1H-PYRROLO[3,2-C]PYRIDINE-2-CARBOXYLIC ACID

CAS: 800401-54-1

Formula: C₈H₅ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.5905

Ref: IN-DA0038FN

6-Chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylic acid

CAS: 800401-54-1

6-Chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylic acid

Purity: 96%

Molecular weight: 196.59g/mol

Ref: 54-OR77752

6-Chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylic acid

CAS: 800401-54-1

Formula: C₈H₅ClN₂O₂

Purity: 96%

Molecular weight: 196.59

Ref: 10-F093252