CAS 800401-63-2

5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

Description:

5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a chlorine substituent at the 5-position of the pyrrole ring and a carboxylic acid functional group at the 2-position of the pyridine ring. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the carboxylic acid group suggests it can participate in various chemical reactions, including esterification and amidation. Additionally, the chlorine atom may influence the compound's lipophilicity and reactivity, affecting its pharmacokinetic properties. This compound is typically synthesized through multi-step organic reactions, and its properties can be further explored through techniques such as NMR spectroscopy and mass spectrometry. As with many heterocycles, it may exhibit unique electronic properties, making it a candidate for further research in fields such as agrochemicals or pharmaceuticals.

Formula: C₈H₅ClN₂O₂

InChI: InChI=1S/C8H5ClN2O2/c9-7-2-1-4-5(11-7)3-6(10-4)8(12)13/h1-3,10H,(H,12,13)

InChI key: InChIKey=LTAXMSVURJPVQV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1NC=2C(C1)=NC(Cl)=CC2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-2-carboxylic acid, 5-chloro-
• 5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

CAS: 800401-63-2

Formula: C₈H₅ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.5905

Ref: IN-DA00G5NO

5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

CAS: 800401-63-2

5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

Purity: 97%

Molecular weight: 196.59g/mol

Ref: 54-OR92607

5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

CAS: 800401-63-2

Formula: C₈H₅ClN₂O₂

Purity: 97%

Color and Shape: No data available.

Molecular weight: 196.59

Ref: 10-F243934