CymitQuimica logo

CAS 800401-84-7

:

5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid

Description:
5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position and a carboxylic acid functional group at the 2-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits moderate stability under standard conditions but may be sensitive to strong acids or bases, which can lead to hydrolysis or other reactions. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's molecular framework may also facilitate various synthetic transformations, enabling the introduction of additional functional groups for further chemical exploration. Overall, 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a versatile building block in organic synthesis and has potential applications in pharmaceuticals and agrochemicals.
Formula:C8H5ClN2O2
InChI:InChI=1/C8H5ClN2O2/c9-5-1-4-2-6(8(12)13)11-7(4)10-3-5/h1-3H,(H,10,11)(H,12,13)
InChI key:YMSGAOPCRLRFMT-UHFFFAOYSA-N
SMILES:c1c2cc(C(=O)O)[nH]c2ncc1Cl
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-chloro-
  • acide 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylique
  • 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylicacid
Found 4 products.