
CAS 800401-88-1
:5-Cyano-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid
Description:
5-Cyano-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a cyano group (-CN) and a carboxylic acid group (-COOH), which contribute to its chemical reactivity and potential applications in medicinal chemistry. The presence of the cyano group enhances its ability to participate in nucleophilic reactions, while the carboxylic acid group can engage in hydrogen bonding and serve as a site for further functionalization. The compound's unique bicyclic structure may impart specific biological activities, making it of interest in drug discovery and development. Additionally, its solubility and stability in various solvents can influence its behavior in chemical reactions and biological systems. Overall, 5-Cyano-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis, warranting further investigation into its properties and uses.
Formula:C9H5N3O2
InChI:InChI=1S/C9H5N3O2/c10-3-6-1-5-2-7(9(13)14)12-8(5)4-11-6/h1-2,4,12H,(H,13,14)
InChI key:InChIKey=DXYLYCVOQBQXJU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(N1)=CN=C(C#N)C2
Synonyms:- 5-Cyano-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid
- 1H-Pyrrolo[2,3-c]pyridine-2-carboxylic acid, 5-cyano-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.