CAS 800402-06-6

6-chloro-3-iodo-pyridin-2-amine

Description:

6-Chloro-3-iodo-pyridin-2-amine is a heterocyclic organic compound characterized by the presence of a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The compound features a chlorine atom at the 6-position and an iodine atom at the 3-position of the pyridine ring, along with an amino group (-NH2) at the 2-position. This substitution pattern contributes to its unique chemical properties, including potential reactivity in nucleophilic substitution reactions due to the presence of the amino group. The halogen substituents (chlorine and iodine) can also influence the compound's reactivity and stability, making it of interest in various synthetic applications, particularly in medicinal chemistry and material science. The presence of halogens often enhances the compound's lipophilicity, which can affect its biological activity and interaction with other molecules. Additionally, the compound's molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where modifications to the pyridine ring can lead to diverse biological activities.

Formula: C₅H₄ClIN₂

InChI: InChI=1/C5H4ClIN2/c6-4-2-1-3(7)5(8)9-4/h1-2H,(H2,8,9)

SMILES: c1cc(Cl)nc(c1I)N

Synonyms:

• 6-Chloro-3-Iodopyridin-2-Amine

6-chloro-3-iodopyridin-2-amine

CAS: 800402-06-6

Formula: C₅H₄ClIN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.4561

Ref: IN-DA0036JQ

6-Chloro-3-iodopyridin-2-amine

CAS: 800402-06-6

6-Chloro-3-iodopyridin-2-amine

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.46g/mol

Ref: 54-OR46764

6-Chloro-3-iodopyridin-2-ylamine

CAS: 800402-06-6

Formula: C₅H₄ClIN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 254.46

Ref: 10-F212128