
CAS 800402-13-5
:rel-(3R,4S)-3,4-Dimethoxypyrrolidine
Description:
Rel-(3R,4S)-3,4-Dimethoxypyrrolidine is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered cyclic amine. The specific stereochemistry indicated by the (3R,4S) configuration suggests that the compound has two chiral centers, influencing its biological activity and interactions. The presence of two methoxy groups (-OCH3) at the 3 and 4 positions of the pyrrolidine ring enhances its solubility in organic solvents and may affect its reactivity and pharmacological properties. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential role as a building block in the synthesis of more complex molecules. Its unique structure may also contribute to specific interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, the stability, reactivity, and potential applications of rel-(3R,4S)-3,4-Dimethoxypyrrolidine can be influenced by environmental factors such as temperature and pH.
Formula:C6H13NO2
InChI:InChI=1/C6H13NO2/c1-8-5-3-7-4-6(5)9-2/h5-7H,3-4H2,1-2H3/t5-,6+
InChI key:InChIKey=CROOPTGQTSCWCM-OLQVQODUNA-N
SMILES:O(C)[C@H]1[C@@H](OC)CNC1
Synonyms:- Pyrrolidine, 3,4-dimethoxy-, (3R,4S)-
- rel-(3S,4R)-3,4-Dimethoxypyrrolidine
- rel-(3R,4S)-3,4-Dimethoxypyrrolidine
- cis-3,4-Dimethoxypyrrolidine
- Pyrrolidine, 3,4-dimethoxy-, (3R,4S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.