CAS 80041-89-0
:Isopropylboronic acid
Description:
Isopropylboronic acid, with the CAS number 80041-89-0, is an organoboron compound characterized by the presence of a boronic acid functional group attached to an isopropyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Isopropylboronic acid is known for its ability to form stable complexes with various substrates, making it valuable in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, which are essential for constructing carbon-carbon bonds. The boronic acid moiety allows for reversible interactions with diols, enabling its use in sensing applications and as a building block in the synthesis of pharmaceuticals and agrochemicals. Additionally, isopropylboronic acid is soluble in polar organic solvents, which facilitates its incorporation into various chemical reactions. Safety considerations include handling it with care due to potential irritant properties, and it should be stored in a cool, dry place away from moisture to maintain its stability.
Formula:C3H9BO2
InChI:InChI=1/C3H9BO2/c1-3(2)4(5)6/h3,5-6H,1-2H3
SMILES:CC(C)B(O)O
Synonyms:- 2-Propaneboronic acid
- (1-Methylethyl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Isopropylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C3H9BO2Purity:96.0 to 126.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:87.91Isopropylboronic acid
CAS:Isopropylboronic acidFormula:C3H9BO2Purity:98%Color and Shape: white solidMolecular weight:87.91g/mol(1-Methylethyl)boronic acid
CAS:<p>(1-Methylethyl)boronic acid is a boronic acid that can be used as a catalyst in organic synthesis. This compound is an organometallic compound that has been shown to be a good catalyst for the polymerization of olefins, and for the preparation of copolymers with polyenes. It can also be used in asymmetric synthesis and as a site-specific ligand in transition metal catalyzed reactions. (1-Methylethyl)boronic acid has been shown to inhibit protease activity and may have therapeutic potential for metabolic disorders such as obesity.</p>Formula:C3H9BO2Purity:Min. 95%Color and Shape:PowderMolecular weight:87.91 g/molIsopropylboronic acid
CAS:Formula:C3H9BO2Purity:95%Color and Shape:Solid, Crystalline Powder or FlakesMolecular weight:87.91Isopropylboronic Acid extrapure, 97%
CAS:Formula:C3H9BO2Purity:min. 97%Color and Shape:White, Crystalline compoundMolecular weight:88.00
