CymitQuimica logo

CAS 80041-99-2

:

methyl 2-[(4-hydroxyisoxazolidin-2-yl)carbonyl]benzoate

Description:
Methyl 2-[(4-hydroxyisoxazolidin-2-yl)carbonyl]benzoate, identified by its CAS number 80041-99-2, is a chemical compound that features a benzoate moiety linked to a hydroxyisoxazolidine structure. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid or solid, depending on its purity and form. It is likely to be soluble in organic solvents, while its solubility in water may be limited due to the presence of hydrophobic aromatic and aliphatic groups. The hydroxyisoxazolidine component suggests potential biological activity, possibly influencing its reactivity and interactions in biological systems. The presence of the carbonyl group indicates that it may participate in various chemical reactions, including nucleophilic attacks and esterification. Additionally, the compound may exhibit specific optical properties due to its chiral centers, which could be relevant in pharmaceutical applications. Overall, methyl 2-[(4-hydroxyisoxazolidin-2-yl)carbonyl]benzoate represents a unique structure with potential utility in medicinal chemistry and related fields.
Formula:C12H13NO5
InChI:InChI=1/C12H13NO5/c1-17-12(16)10-5-3-2-4-9(10)11(15)13-6-8(14)7-18-13/h2-5,8,14H,6-7H2,1H3
SMILES:COC(=O)c1ccccc1C(=O)N1CC(CO1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.