CAS 80051-04-3

(1S)-1-(3-chlorophenyl)ethane-1,2-diol

Description:

(1S)-1-(3-chlorophenyl)ethane-1,2-diol, identified by its CAS number 80051-04-3, is a chiral organic compound characterized by the presence of a chlorophenyl group and two hydroxyl (-OH) functional groups attached to a two-carbon ethane backbone. This compound exhibits properties typical of diols, including the ability to engage in hydrogen bonding due to its hydroxyl groups, which can influence its solubility in polar solvents like water. The presence of the 3-chlorophenyl substituent can impart unique electronic and steric effects, potentially affecting the compound's reactivity and interaction with biological systems. As a chiral molecule, it exists in two enantiomeric forms, which may exhibit different biological activities or pharmacological effects. The compound's structural features suggest potential applications in pharmaceuticals or as intermediates in organic synthesis, although specific applications would depend on further research into its properties and behavior in various chemical environments.

Formula: C₈H₉ClO₂

InChI: InChI=1/C8H9ClO2/c9-7-3-1-2-6(4-7)8(11)5-10/h1-4,8,10-11H,5H2/t8-/m1/s1

SMILES: c1cc(cc(c1)Cl)[C@@H](CO)O

(R)-1-(3-Chlorophenyl)-1,2-ethanediol

CAS: 80051-04-3

Formula: C₈H₉ClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.6089

Ref: IN-DA005PDC

(R)-1-(3-Chlorophenyl)-1,2-ethanediol

CAS: 80051-04-3

Formula: C₈H₉ClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.61

Ref: 10-F228060