CAS 80065-56-1

N~2~-{6-methoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-yl}pentane-1,2-diamine

Description:

N~2~-{6-methoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-yl}pentane-1,2-diamine, identified by its CAS number 80065-56-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline core substituted with various functional groups. The presence of a methoxy group and a trifluoromethyl group contributes to its unique chemical properties, potentially influencing its solubility, reactivity, and biological activity. The pentane-1,2-diamine moiety suggests that the compound may exhibit basic properties due to the amine functionalities, which can participate in hydrogen bonding and may affect its interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological applications, although specific biological activities and mechanisms of action would require further investigation. Overall, its structural complexity and the presence of diverse functional groups make it a candidate for studies in drug development and chemical synthesis.

Formula: C₂₃H₂₆F₃N₃O₂

InChI: InChI=1/C23H26F3N3O2/c1-4-6-16(13-27)29-18-12-19(30-3)22(20-14(2)9-10-28-21(18)20)31-17-8-5-7-15(11-17)23(24,25)26/h5,7-12,16,29H,4,6,13,27H2,1-3H3

SMILES: CCCC(CN)Nc1cc(c(c2c(C)ccnc12)Oc1cccc(c1)C(F)(F)F)OC