CymitQuimica logo

CAS 80066-72-4

:

5-Nitro-3-isoquinolinecarboxylic acid

Description:
5-Nitro-3-isoquinolinecarboxylic acid is an organic compound characterized by its isoquinoline structure, which features a fused bicyclic aromatic system. The presence of a nitro group at the 5-position and a carboxylic acid functional group at the 3-position contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its nitro group can participate in electrophilic substitution reactions, while the carboxylic acid can engage in acid-base reactions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its unique structural features may allow for interactions with various biological targets, potentially leading to therapeutic applications. As with many nitro compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental concerns. Overall, 5-Nitro-3-isoquinolinecarboxylic acid represents a valuable compound for research in organic synthesis and pharmacology.
Formula:C10H6N2O4
InChI:InChI=1S/C10H6N2O4/c13-10(14)8-4-7-6(5-11-8)2-1-3-9(7)12(15)16/h1-5H,(H,13,14)
InChI key:InChIKey=YLFNFIOMMHOGMA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C=NC(C(O)=O)=C2)C=CC1
Synonyms:
  • 3-Isoquinolinecarboxylic acid, 5-nitro-
  • 5-Nitro-3-isoquinolinecarboxylic acid
  • 3-Carboxy-5-nitroisoquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.