CAS 80074-26-6
:5-[(chloroacetyl)amino]-2-hydroxybenzoic acid
Description:
5-[(Chloroacetyl)amino]-2-hydroxybenzoic acid, also known by its CAS number 80074-26-6, is a chemical compound that features both an amino group and a hydroxyl group, making it a derivative of salicylic acid. This compound is characterized by the presence of a chloroacetyl group, which enhances its reactivity and potential applications in medicinal chemistry. It typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its functional groups' ability to engage in hydrogen bonding. The compound's structure suggests it may exhibit biological activity, potentially serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety data should be consulted for handling, as the chloroacetyl moiety can be hazardous. Overall, this compound represents a significant interest in organic synthesis and medicinal applications due to its functional versatility.
Formula:C9H8ClNO4
InChI:InChI=1/C9H8ClNO4/c10-4-8(13)11-5-1-2-7(12)6(3-5)9(14)15/h1-3,12H,4H2,(H,11,13)(H,14,15)
SMILES:c1cc(c(cc1N=C(CCl)O)C(=O)O)O
Synonyms:- Benzoic Acid, 5-[(2-Chloroacetyl)Amino]-2-Hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.