CymitQuimica logo

CAS 80074-34-6

:

Benzoic acid, 2-ethoxy-5-nitro-, methyl ester

Description:
Benzoic acid, 2-ethoxy-5-nitro-, methyl ester, with the CAS number 80074-34-6, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a nitro group and an ethoxy substituent on the benzene ring, contributing to its unique chemical properties. Typically, it appears as a solid or liquid at room temperature, depending on its purity and specific conditions. The presence of the nitro group often imparts increased reactivity, making it useful in various chemical syntheses. Additionally, the ethoxy group enhances its solubility in organic solvents, which can be advantageous in applications such as pharmaceuticals or agrochemicals. The compound may exhibit biological activity, and its derivatives are often studied for potential uses in medicinal chemistry. As with many nitro compounds, it is essential to handle this substance with care due to potential toxicity and environmental considerations. Proper safety measures should be observed when working with this chemical in laboratory settings.
Formula:C10H11NO5
InChI:InChI=1S/C10H11NO5/c1-3-16-9-5-4-7(11(13)14)6-8(9)10(12)15-2/h4-6H,3H2,1-2H3
InChI key:InChIKey=ALHAOIFZKFHHAJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(OCC)C=CC(N(=O)=O)=C1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.