CAS 80081-06-7
:O-6-Deoxy-α-L-galactopyranosyl-(1→4)-O-[O-6-deoxy-α-L-galactopyranosyl-(1→2)-β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-β-D-glucopyranose
Description:
O-6-Deoxy-α-L-galactopyranosyl-(1→4)-O-[O-6-deoxy-α-L-galactopyranosyl-(1→2)-β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-β-D-glucopyranose, with CAS number 80081-06-7, is a complex glycosylated compound characterized by its intricate carbohydrate structure. This substance features multiple sugar units, including α-L-galactopyranose and β-D-galactopyranose, linked through specific glycosidic bonds, which contribute to its unique properties. The presence of an acetylamino group indicates potential biological activity, as such modifications can influence solubility, reactivity, and interactions with biological macromolecules. This compound may exhibit specific roles in biological systems, such as in cell recognition or signaling processes, due to its structural complexity. Its synthesis and characterization typically involve advanced techniques in carbohydrate chemistry, including chromatography and spectroscopy, to elucidate its structure and confirm its identity. Overall, this compound represents a fascinating example of glycosylation in organic chemistry, with potential applications in biochemistry and pharmaceuticals.
Formula:C26H45NO19
InChI:InChI=1S/C26H45NO19/c1-6-12(31)15(34)18(37)24(40-6)44-20-10(5-29)42-23(39)11(27-8(3)30)21(20)45-26-22(17(36)14(33)9(4-28)43-26)46-25-19(38)16(35)13(32)7(2)41-25/h6-7,9-26,28-29,31-39H,4-5H2,1-3H3,(H,27,30)/t6-,7-,9+,10+,11+,12+,13+,14-,15+,16+,17-,18-,19-,20+,21+,22+,23+,24-,25-,26-/m0/s1
InChI key:InChIKey=OXNGKCPRVRBHPO-XLMUYGLTSA-N
SMILES:O([C@H]1[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@H](O)[C@H](C)O2)[C@@H](CO)O[C@@H](O)[C@@H]1NC(C)=O)[C@H]3[C@H](O[C@H]4[C@@H](O)[C@H](O)[C@H](O)[C@H](C)O4)[C@@H](O)[C@@H](O)[C@@H](CO)O3
Synonyms:- β-D-Glucopyranose, O-6-deoxy-α-L-galactopyranosyl-(1→4)-O-[O-6-deoxy-α-L-galactopyranosyl-(1→2)-β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-
- O-6-Deoxy-α-L-galactopyranosyl-(1→4)-O-[O-6-deoxy-α-L-galactopyranosyl-(1→2)-β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-β-D-glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Lewis B tetrasaccharide
CAS:Formula:C26H45N1O19Purity:≥ 90%Color and Shape:White crystalline powder or solidMolecular weight:675.63Lewis B tetrasaccharide
CAS:Lewis B tetrasaccharide (LBT) is a glycosylated oligosaccharide that is found in the outer membrane of human pathogens, such as Helicobacter pylori. LBT has been shown to inhibit the growth of cancer cells and may be used as a potential therapeutic agent for cancer treatment. It has also been shown to have structural features similar to those found in inflammatory bowel disease patients, suggesting that it may play a role in regulating bowel inflammation. LBT is recognized by monoclonal antibodies and can be used to detect H. pylori in biological samples. Lewis B tetrasaccharide binds with methyl glycosides on human erythrocytes, which inhibits the polymerase chain reaction (PCR). This inhibition leads to reduced DNA synthesis and a decrease in bacterial replication, making it an effective antimicrobial agent.Formula:C26H45NO19Purity:Min. 90%Color and Shape:White PowderMolecular weight:675.63 g/mol



