CAS 80087-26-9

1-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]propan-2-one

Description:

1-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]propan-2-one, with the CAS number 80087-26-9, is a chemical compound characterized by its unique structure that includes a tetrazole ring and a thioether functional group. This compound features a propan-2-one backbone, which contributes to its ketone functionality. The presence of the tetrazole moiety imparts notable properties, such as potential biological activity and the ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The sulfur atom in the thioether group enhances its reactivity and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]propan-2-one represents a versatile structure with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₅H₈N₄OS

InChI: InChI=1/C5H8N4OS/c1-4(10)3-11-5-6-7-8-9(5)2/h3H2,1-2H3