CymitQuimica logo

CAS 80089-25-4

:

Proline, phenylmethyl ester

Description:
Proline, phenylmethyl ester, also known as phenylmethyl proline or benzyl proline, is an amino acid derivative characterized by the presence of a proline backbone with a phenylmethyl (benzyl) ester functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water due to its hydrophobic benzyl group. Proline itself is a non-polar, cyclic amino acid that plays a crucial role in protein structure and stability, particularly in collagen. The esterification of proline enhances its lipophilicity, which can influence its biological activity and interactions with other molecules. Proline, phenylmethyl ester is often utilized in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its unique structure allows it to participate in various chemical reactions, including peptide bond formation and other coupling reactions, making it a valuable compound in medicinal chemistry and biochemistry.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10/h1-3,5-6,11,13H,4,7-9H2
InChI key:InChIKey=VVCLBQFBKZQOAF-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)C2CCCN2
Synonyms:
  • 2-(Benzyloxycarbonyl)pyrrolidine
  • DL-Proline benzyl ester
  • Proline, phenylmethyl ester
  • DL-Proline, phenylmethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.