CymitQuimica logo

CAS 80097-15-0

:

1-methyl-4-oxo-5-[3-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylic acid

Description:
1-Methyl-4-oxo-5-[3-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylic acid is a chemical compound that belongs to the class of dihydropyridines, which are characterized by a six-membered ring containing nitrogen. This specific compound features a methyl group and a carboxylic acid functional group, contributing to its acidic properties. The presence of a trifluoromethyl group on the phenyl ring enhances its lipophilicity and can influence its biological activity. The dihydropyridine structure is often associated with various pharmacological activities, including calcium channel blocking properties. The compound may exhibit solubility in organic solvents, while its carboxylic acid group can impart some degree of solubility in polar solvents. Additionally, the trifluoromethyl group can significantly affect the compound's electronic properties, potentially enhancing its reactivity and interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and drug development, particularly in the design of cardiovascular agents or other therapeutic agents.
Formula:C14H10F3NO3
InChI:InChI=1/C14H10F3NO3/c1-18-6-10(12(19)11(7-18)13(20)21)8-3-2-4-9(5-8)14(15,16)17/h2-7H,1H3,(H,20,21)
SMILES:Cn1cc(c2cccc(c2)C(F)(F)F)c(=O)c(c1)C(=O)O
Found 1 products.