CAS 80099-81-6
:(2-chloropyridin-3-yl)(phenyl)methanone
Description:
(2-Chloropyridin-3-yl)(phenyl)methanone, with the CAS number 80099-81-6, is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a phenyl group attached to a carbonyl moiety. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the chloropyridine and phenyl groups contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of biologically active compounds. Additionally, the compound's properties can be influenced by factors such as temperature and pH, which may affect its stability and reactivity in different environments.
Formula:C12H9Cl2NO
InChI:InChI=1/C12H8ClNO.ClH/c13-12-10(7-4-8-14-12)11(15)9-5-2-1-3-6-9;/h1-8H;1H
SMILES:c1ccc(cc1)C(=O)c1cccnc1Cl.Cl
Synonyms:- 2-Chloro-3-pyridinyl phenyl ketone
- 2-Chloro-3-pyridyl phenyl ketone
- 2-Chloropyrid-3-yl phenyl ketone
- 2-Chloropyridin-3-yl phenyl ketone
- Methanone, (2-Chloro-3-Pyridinyl)Phenyl-
- T6Nj Bg Cvr [Wln]
- (2-Chloropyridin-3-Yl)(Phenyl)Methanone Hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
