CAS 80100-09-0

[1,1′-Biphenyl]-4-yl(2-chloro-4-pyridinyl)methanone

Description:

[1,1′-Biphenyl]-4-yl(2-chloro-4-pyridinyl)methanone, with the CAS number 80100-09-0, is an organic compound characterized by its biphenyl structure substituted with a ketone group and a chloropyridine moiety. This compound typically exhibits a solid state at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique structural features. The presence of the biphenyl group contributes to its stability and hydrophobic characteristics, while the chloropyridine enhances its reactivity and potential for forming hydrogen bonds. The ketone functional group is indicative of its ability to participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility and reactivity can vary based on the solvent and conditions, which is crucial for its application in synthesis and formulation. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₈H₁₂ClNO

InChI: InChI=1S/C18H12ClNO/c19-17-12-16(10-11-20-17)18(21)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H

InChI key: InChIKey=SVWNIEJSQQUONV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2=CC=CC=C2)C=3C=C(Cl)N=CC3

Synonyms:

• Methanone, [1,1′-biphenyl]-4-yl(2-chloro-4-pyridinyl)-
• [1,1′-Biphenyl]-4-yl(2-chloro-4-pyridinyl)methanone
• 2-Chloro-4-(4-phenylbenzoyl)pyridine

[1,1'-biphenyl]-4-yl(2-chloropyridin-4-yl)methanone

CAS: 80100-09-0

Formula: C₁₈H₁₂ClNO

Purity: 95%

Molecular weight: 293.7470

Ref: IN-DA01DJ8I

[1,1'-biphenyl]-4-yl(2-chloropyridin-4-yl)methanone

CAS: 80100-09-0

Purity: 95%

Molecular weight: 293.75

Ref: 10-F614704