CymitQuimica logo

CAS 801152-34-1

:

1-(2-bromoethyl)-4-methyl-piperazine dihydrobromide

Description:
1-(2-Bromoethyl)-4-methyl-piperazine dihydrobromide is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a bromoethyl group at the 1-position and a methyl group at the 4-position contributes to its unique reactivity and properties. This compound is typically encountered as a dihydrobromide salt, indicating that it is protonated and stabilized by bromide ions. It is likely to be soluble in polar solvents due to the presence of the bromide ions and the piperazine structure, which can engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests potential interactions with biological targets, which could be explored in drug design. Safety and handling precautions are essential, as the presence of bromine can indicate potential toxicity or reactivity. As with all chemical substances, proper characterization through techniques such as NMR, IR, and mass spectrometry is crucial for confirming its identity and purity.
Formula:C7H17Br3N2
InChI:InChI=1/C7H15BrN2.2BrH/c1-9-4-6-10(3-2-8)7-5-9;;/h2-7H2,1H3;2*1H
SMILES:CN1CCN(CCBr)CC1.Br.Br
Synonyms:
  • 1-(2-Bromoethyl)-4-Methylpiperazine Dihydrobromide
  • Piperazine, 1-(2-bromoethyl)-4-methyl-, hydrobromide (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.