CAS 801161-36-4
:phthalazine-1-carboxylic acid
Description:
Phthalazine-1-carboxylic acid is an organic compound characterized by its phthalazine core structure, which consists of a fused bicyclic ring system containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 1-position of the phthalazine ring, contributing to its acidic properties. Phthalazine derivatives are known for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of the carboxylic acid group enhances its solubility in polar solvents and can facilitate various chemical reactions, such as esterification or amidation. Additionally, phthalazine-1-carboxylic acid may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. As with many organic compounds, the specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C9H6N2O2
InChI:InChI=1/C9H6N2O2/c12-9(13)8-7-4-2-1-3-6(7)5-10-11-8/h1-5H,(H,12,13)
Synonyms:- 1-phthalazinecarboxylic acid
- Phthalazine-1-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
