
CAS 80118-06-5
:1,3-Dimethyl-3-butenyl 2-methylpropionate
Description:
1,3-Dimethyl-3-butenyl 2-methylpropionate, with the CAS number 80118-06-5, is an organic compound that belongs to the class of esters. It is characterized by its structure, which includes a butenyl group and a methylpropionate moiety. This compound typically exhibits a pleasant, fruity aroma, making it useful in the fragrance and flavor industry. It is a colorless to pale yellow liquid at room temperature and is generally soluble in organic solvents. The compound's chemical properties include its ability to undergo typical ester reactions, such as hydrolysis and transesterification. Additionally, it may exhibit some degree of volatility, which is a common trait among many esters. Safety data indicates that, like many organic compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, 1,3-Dimethyl-3-butenyl 2-methylpropionate is valued for its sensory properties and potential applications in various formulations.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c1-7(2)6-9(5)12-10(11)8(3)4/h8-9H,1,6H2,2-5H3
InChI key:InChIKey=JJWWUTCHOAKZPR-UHFFFAOYSA-N
SMILES:C(OC(C(C)C)=O)(CC(C)=C)C
Synonyms:- Propanoic acid, 2-methyl-, 1,3-dimethyl-3-butenyl ester
- 1,3-Dimethyl-3-butenyl 2-methylpropionate
- Propanoic acid, 2-methyl-, 1,3-dimethyl-3-buten-1-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.