CAS 80120-33-8

ethyl 2-(2,4-dimethylphenyl)-2-oxo-acetate

Description:

Ethyl 2-(2,4-dimethylphenyl)-2-oxo-acetate, with the CAS number 80120-33-8, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a phenyl ring substituted with two methyl groups at the 2 and 4 positions, contributing to its hydrophobic characteristics and potential biological activity. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical applications. Ethyl 2-(2,4-dimethylphenyl)-2-oxo-acetate may exhibit interesting reactivity due to the carbonyl group, which can participate in nucleophilic addition reactions. Additionally, its structural features suggest potential applications in the synthesis of pharmaceuticals or agrochemicals, where the unique substitution pattern could influence biological interactions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound exemplifies the complexity and utility of substituted aromatic esters in organic chemistry.

Formula: C₁₂H₁₄O₃

InChI: InChI=1/C12H14O3/c1-4-15-12(14)11(13)10-6-5-8(2)7-9(10)3/h5-7H,4H2,1-3H3

SMILES: CCOC(=O)C(=O)c1ccc(C)cc1C

Synonyms:

• Benzeneacetic Acid, 2,4-Dimethyl-Α-Oxo-, Ethyl Ester
• Ethyl (2,4-dimethylphenyl)(oxo)acetate