CAS 80120-38-3
:ethyl 2-oxo-2-(2,3,5,6-tetramethylphenyl)acetate
Description:
Ethyl 2-oxo-2-(2,3,5,6-tetramethylphenyl)acetate, with the CAS number 80120-38-3, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a bulky tetramethylphenyl group, which contributes to its unique physical and chemical properties. Typically, such esters are known for their pleasant fruity aromas, making them useful in flavor and fragrance applications. The presence of the ketone group suggests potential reactivity in various chemical reactions, including nucleophilic additions. Ethyl 2-oxo-2-(2,3,5,6-tetramethylphenyl)acetate may exhibit moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as temperature and light. Additionally, the steric hindrance from the tetramethyl groups can affect its reactivity and interactions with other molecules. Overall, this compound is of interest in synthetic organic chemistry and may have applications in the development of new materials or pharmaceuticals.
Formula:C14H18O3
InChI:InChI=1/C14H18O3/c1-6-17-14(16)13(15)12-10(4)8(2)7-9(3)11(12)5/h7H,6H2,1-5H3
SMILES:CCOC(=O)C(=O)c1c(C)c(C)cc(C)c1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.