
CAS 80121-73-9
:[2-(Iodomethyl)-2-propen-1-yl]trimethylsilane
Description:
[2-(Iodomethyl)-2-propen-1-yl]trimethylsilane, with the CAS number 80121-73-9, is an organosilicon compound characterized by the presence of a trimethylsilyl group attached to a vinyl structure that includes an iodomethyl substituent. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of both the vinyl and iodomethyl groups, which can participate in various chemical reactions, including nucleophilic substitutions and polymerization processes. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in synthetic organic chemistry. Additionally, its unique structure allows it to serve as a versatile reagent in the formation of carbon-carbon bonds and in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of iodine and its potential reactivity.
Formula:C7H15ISi
InChI:InChI=1S/C7H15ISi/c1-7(5-8)6-9(2,3)4/h1,5-6H2,2-4H3
InChI key:InChIKey=FLDGWNPNLFEXIQ-UHFFFAOYSA-N
SMILES:C([Si](C)(C)C)C(CI)=C
Synonyms:- 3-Iodo-2-(trimethylsilylmethyl)-1-propene
- [2-(Iodomethyl)-2-propen-1-yl]trimethylsilane
- Silane, [2-(iodomethyl)-2-propen-1-yl]trimethyl-
- 2-(Trimethylsilyl)methallyl iodide
- Silane, [2-(iodomethyl)-2-propenyl]trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.