CAS 801212-59-9

2,2,3,3,4,4,5,5,5-nonafluoropentyl 4-methylbenzenesulfonate

Description:

2,2,3,3,4,4,5,5,5-nonafluoropentyl 4-methylbenzenesulfonate is a fluorinated organic compound characterized by its complex structure, which includes a nonafluoropentyl group and a 4-methylbenzenesulfonate moiety. This compound is notable for its high degree of fluorination, which imparts unique properties such as increased hydrophobicity and thermal stability. The presence of the sulfonate group enhances its solubility in polar solvents, making it useful in various applications, including as a surfactant or in the synthesis of other fluorinated compounds. Its fluorinated nature also suggests potential applications in fields such as materials science and pharmaceuticals, where fluorinated compounds are often sought for their distinctive chemical behavior. However, due to the environmental and health concerns associated with per- and polyfluoroalkyl substances (PFAS), the use and disposal of such compounds are subject to regulatory scrutiny. Overall, 2,2,3,3,4,4,5,5,5-nonafluoropentyl 4-methylbenzenesulfonate exemplifies the intersection of advanced chemical design and environmental considerations.

Formula: C₁₂H₉F₉O₃S

InChI: InChI=1/C12H9F9O3S/c1-7-2-4-8(5-3-7)25(22,23)24-6-9(13,14)10(15,16)11(17,18)12(19,20)21/h2-5H,6H2,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)OCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F

Synonyms:

• 1-Pentanol, 2,2,3,3,4,4,5,5,5-Nonafluoro-, 4-Methylbenzenesulfonate