CAS 801228-16-0
:β,3,5-Trimethyl-1H-1,2,4-triazole-1-propanoic acid
Description:
β,3,5-Trimethyl-1H-1,2,4-triazole-1-propanoic acid, identified by its CAS number 801228-16-0, is a chemical compound characterized by its triazole ring structure, which contributes to its unique chemical properties. This compound features three methyl groups at the 3 and 5 positions of the triazole ring, enhancing its lipophilicity and potentially influencing its biological activity. The presence of a propanoic acid moiety suggests that it may exhibit acidic properties, which can affect its solubility and reactivity in various environments. Typically, compounds of this nature are studied for their potential applications in agriculture, particularly as plant growth regulators or fungicides, due to their ability to modulate plant physiological processes. Additionally, the triazole ring is known for its role in various pharmacological applications, including antifungal activity. Overall, β,3,5-Trimethyl-1H-1,2,4-triazole-1-propanoic acid represents a versatile compound with potential utility in both agricultural and pharmaceutical contexts.
Formula:C8H13N3O2
InChI:InChI=1S/C8H13N3O2/c1-5(4-8(12)13)11-7(3)9-6(2)10-11/h5H,4H2,1-3H3,(H,12,13)
InChI key:InChIKey=MCTPUSHEGYKPKV-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C)N1N=C(C)N=C1C
Synonyms:- 1H-1,2,4-Triazole-1-propanoic acid, β,3,5-trimethyl-
- β,3,5-Trimethyl-1H-1,2,4-triazole-1-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.