CAS 801228-17-1
:α-[(Methylamino)methyl]-2-(trifluoromethyl)-1H-benzimidazole-1-ethanol
Description:
α-[(Methylamino)methyl]-2-(trifluoromethyl)-1H-benzimidazole-1-ethanol, identified by its CAS number 801228-17-1, is a chemical compound that features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring. This compound is characterized by the presence of a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The methylamino group contributes to its potential as a pharmacophore, suggesting possible interactions with biological targets. The presence of the ethanol moiety indicates that it may exhibit solubility in polar solvents, which can be advantageous for formulation in pharmaceutical applications. Additionally, the trifluoromethyl group is known to impart unique electronic properties, potentially affecting the compound's reactivity and stability. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H14F3N3O
InChI:InChI=1S/C12H14F3N3O/c1-16-6-8(19)7-18-10-5-3-2-4-9(10)17-11(18)12(13,14)15/h2-5,8,16,19H,6-7H2,1H3
InChI key:InChIKey=YZDOPYVGAQAWIW-UHFFFAOYSA-N
SMILES:C(C(CNC)O)N1C=2C(N=C1C(F)(F)F)=CC=CC2
Synonyms:- 1H-Benzimidazole-1-ethanol, α-[(methylamino)methyl]-2-(trifluoromethyl)-
- α-[(Methylamino)methyl]-2-(trifluoromethyl)-1H-benzimidazole-1-ethanol
- 1-METHYLAMINO-3-(2-TRIFLUOROMETHYL-BENZOIMIDAZOL-1-YL)-PROPAN-2-OL
- 1-(methylamino)-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.