CAS 801303-28-6
:ethyl 4-(cyclobutanecarbonyl)benzoate
Description:
Ethyl 4-(cyclobutanecarbonyl)benzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and ethanol, with a cyclobutanecarbonyl substituent at the para position of the aromatic ring. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. Its molecular structure includes a benzoate moiety, which contributes to its aromatic properties, and a cyclobutanecarbonyl group that adds to its complexity and potential reactivity. Ethyl 4-(cyclobutanecarbonyl)benzoate may exhibit interesting chemical behavior due to the presence of both the aromatic and cyclobutane rings, potentially influencing its reactivity in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Additionally, this compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C14H16O3
InChI:InChI=1/C14H16O3/c1-2-17-14(16)12-8-6-11(7-9-12)13(15)10-4-3-5-10/h6-10H,2-5H2,1H3
SMILES:CCOC(=O)c1ccc(cc1)C(=O)C1CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.