
CAS 801306-56-9
:3,6-Dihydro-3′-(trifluoromethyl)[1(2H),2′-bipyridine]-4-carbonitrile
Description:
3,6-Dihydro-3′-(trifluoromethyl)[1(2H),2′-bipyridine]-4-carbonitrile is a chemical compound characterized by its unique structural features, which include a bipyridine core and a trifluoromethyl group. The presence of the carbonitrile functional group contributes to its potential reactivity and solubility properties. This compound typically exhibits a moderate to high polarity due to the electronegative trifluoromethyl group, which can influence its interactions with other molecules. The bipyridine structure often imparts interesting coordination chemistry, making it a candidate for applications in metal complexation and catalysis. Additionally, the dihydro substitution suggests that the compound may exist in a specific conformational state, potentially affecting its biological activity and stability. Overall, 3,6-Dihydro-3′-(trifluoromethyl)[1(2H),2′-bipyridine]-4-carbonitrile is of interest in various fields, including medicinal chemistry and materials science, due to its distinctive properties and potential applications.
Formula:C12H10F3N3
InChI:InChI=1S/C12H10F3N3/c13-12(14,15)10-2-1-5-17-11(10)18-6-3-9(8-16)4-7-18/h1-3,5H,4,6-7H2
InChI key:InChIKey=NCYPWVOGHJWTFF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(N=CC=C1)N2CCC(C#N)=CC2
Synonyms:- [1(2H),2′-Bipyridine]-4-carbonitrile, 3,6-dihydro-3′-(trifluoromethyl)-
- 3,6-Dihydro-3′-(trifluoromethyl)[1(2H),2′-bipyridine]-4-carbonitrile
- 3′-(Trifluoromethyl)-3,6-dihydro-2H-[1,2′-bipyridine]-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.